C25H31N4O4S- — CID 118035285
5-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]methyl-sulfinatoamino]-1-methylindole (PubChem CID 118035285) has the molecular formula C25H31N4O4S- and a molecular weight of 483.61 g/mol. Its IUPAC name is 5-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]methyl-sulfinatoamino]-1-methylindole.
| Compound Name | 5-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]methyl-sulfinatoamino]-1-methylindole |
|---|---|
| PubChem CID | 118035285 |
| Molecular Formula | C25H31N4O4S- |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 5-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]methyl-sulfinatoamino]-1-methylindole |
| SMILES | Cn1ccc2cc(N(CC3(C(=O)NC4C5CC6CC4CC(C(N)=O)(C6)C5)CC3)S(=O)[O-])ccc21 |
| InChI | InChI=1S/C25H32N4O4S/c1-28-7-4-16-10-19(2-3-20(16)28)29(34(32)33)14-24(5-6-24)23(31)27-21-17-8-15-9-18(21)13-25(11-15,12-17)22(26)30/h2-4,7,10,15,17-18,21H,5-6,8-9,11-14H2,1H3,(H2,26,30)(H,27,31)(H,32,33)/p-1 |
| InChIKey | KBPSSEULVQQIFI-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|