C19H27N5O4S — CID 118035089
5-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]-sulfinoamino]-1-methylpyrazole (PubChem CID 118035089) has the molecular formula C19H27N5O4S and a molecular weight of 421.52 g/mol. Its IUPAC name is 5-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]-sulfinoamino]-1-methylpyrazole.
| Compound Name | 5-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]-sulfinoamino]-1-methylpyrazole |
|---|---|
| PubChem CID | 118035089 |
| Molecular Formula | C19H27N5O4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 5-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]-sulfinoamino]-1-methylpyrazole |
| SMILES | Cn1nccc1N(S(=O)O)C1(C(=O)NC2C3CC4CC2CC(C(N)=O)(C4)C3)CC1 |
| InChI | InChI=1S/C19H27N5O4S/c1-23-14(2-5-21-23)24(29(27)28)19(3-4-19)17(26)22-15-12-6-11-7-13(15)10-18(8-11,9-12)16(20)25/h2,5,11-13,15H,3-4,6-10H2,1H3,(H2,20,25)(H,22,26)(H,27,28) |
| InChIKey | RUNGUPSXUXQDTJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|