C21H25Cl2N3O4S — CID 71247747
1-carbamoyl-4-[[1-(2,6-dichloro-N-sulfinoanilino)cyclopropanecarbonyl]amino]adamantane (PubChem CID 71247747) has the molecular formula C21H25Cl2N3O4S and a molecular weight of 486.42 g/mol. Its IUPAC name is 1-carbamoyl-4-[[1-(2,6-dichloro-N-sulfinoanilino)cyclopropanecarbonyl]amino]adamantane.
| Compound Name | 1-carbamoyl-4-[[1-(2,6-dichloro-N-sulfinoanilino)cyclopropanecarbonyl]amino]adamantane |
|---|---|
| PubChem CID | 71247747 |
| Molecular Formula | C21H25Cl2N3O4S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 1-carbamoyl-4-[[1-(2,6-dichloro-N-sulfinoanilino)cyclopropanecarbonyl]amino]adamantane |
| SMILES | NC(=O)C12CC3CC(C1)C(NC(=O)C1(N(c4c(Cl)cccc4Cl)S(=O)O)CC1)C(C3)C2 |
| InChI | InChI=1S/C21H25Cl2N3O4S/c22-14-2-1-3-15(23)17(14)26(31(29)30)21(4-5-21)19(28)25-16-12-6-11-7-13(16)10-20(8-11,9-12)18(24)27/h1-3,11-13,16H,4-10H2,(H2,24,27)(H,25,28)(H,29,30) |
| InChIKey | KOPGGZLODHTTMP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|