C24H31BrN3O4S- — CID 71247935
4-[[1-(2-bromo-N-sulfinatoanilino)cyclohexanecarbonyl]amino]-1-carbamoyladamantane (PubChem CID 71247935) has the molecular formula C24H31BrN3O4S- and a molecular weight of 537.50 g/mol. Its IUPAC name is 4-[[1-(2-bromo-N-sulfinatoanilino)cyclohexanecarbonyl]amino]-1-carbamoyladamantane.
| Compound Name | 4-[[1-(2-bromo-N-sulfinatoanilino)cyclohexanecarbonyl]amino]-1-carbamoyladamantane |
|---|---|
| PubChem CID | 71247935 |
| Molecular Formula | C24H31BrN3O4S- |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 4-[[1-(2-bromo-N-sulfinatoanilino)cyclohexanecarbonyl]amino]-1-carbamoyladamantane |
| SMILES | NC(=O)C12CC3CC(C1)C(NC(=O)C1(N(c4ccccc4Br)S(=O)[O-])CCCCC1)C(C3)C2 |
| InChI | InChI=1S/C24H32BrN3O4S/c25-18-6-2-3-7-19(18)28(33(31)32)24(8-4-1-5-9-24)22(30)27-20-16-10-15-11-17(20)14-23(12-15,13-16)21(26)29/h2-3,6-7,15-17,20H,1,4-5,8-14H2,(H2,26,29)(H,27,30)(H,31,32)/p-1 |
| InChIKey | JSIYBPLREKSGQC-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|