C20H26N3O4S2- — CID 118035341
2-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]methyl-sulfinatoamino]thiophene (PubChem CID 118035341) has the molecular formula C20H26N3O4S2- and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]methyl-sulfinatoamino]thiophene.
| Compound Name | 2-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]methyl-sulfinatoamino]thiophene |
|---|---|
| PubChem CID | 118035341 |
| Molecular Formula | C20H26N3O4S2- |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]methyl-sulfinatoamino]thiophene |
| SMILES | NC(=O)C12CC3CC(C1)C(NC(=O)C1(CN(c4cccs4)S(=O)[O-])CC1)C(C3)C2 |
| InChI | InChI=1S/C20H27N3O4S2/c21-17(24)20-8-12-6-13(9-20)16(14(7-12)10-20)22-18(25)19(3-4-19)11-23(29(26)27)15-2-1-5-28-15/h1-2,5,12-14,16H,3-4,6-11H2,(H2,21,24)(H,22,25)(H,26,27)/p-1 |
| InChIKey | LNODNPGEMXIRON-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|