C24H30N4O4S — CID 118035245
7-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]-sulfinoamino]-1-methylindole (PubChem CID 118035245) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is 7-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]-sulfinoamino]-1-methylindole.
| Compound Name | 7-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]-sulfinoamino]-1-methylindole |
|---|---|
| PubChem CID | 118035245 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 7-[[1-[(5-carbamoyl-2-adamantyl)carbamoyl]cyclopropyl]-sulfinoamino]-1-methylindole |
| SMILES | Cn1ccc2cccc(N(S(=O)O)C3(C(=O)NC4C5CC6CC4CC(C(N)=O)(C6)C5)CC3)c21 |
| InChI | InChI=1S/C24H30N4O4S/c1-27-8-5-15-3-2-4-18(20(15)27)28(33(31)32)24(6-7-24)22(30)26-19-16-9-14-10-17(19)13-23(11-14,12-16)21(25)29/h2-5,8,14,16-17,19H,6-7,9-13H2,1H3,(H2,25,29)(H,26,30)(H,31,32) |
| InChIKey | FLWSLZWYOBSJIS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|