C23H26N2O3 — CID 71089626
N-(5-carbamoyl-2-adamantyl)-5-(4-methylphenyl)furan-2-carboxamide (PubChem CID 71089626) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-(5-carbamoyl-2-adamantyl)-5-(4-methylphenyl)furan-2-carboxamide.
| Compound Name | N-(5-carbamoyl-2-adamantyl)-5-(4-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 71089626 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-(5-carbamoyl-2-adamantyl)-5-(4-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC3C4CC5CC3CC(C(N)=O)(C5)C4)o2)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-13-2-4-15(5-3-13)18-6-7-19(28-18)21(26)25-20-16-8-14-9-17(20)12-23(10-14,11-16)22(24)27/h2-7,14,16-17,20H,8-12H2,1H3,(H2,24,27)(H,25,26) |
| InChIKey | AQZJXTYUENKGJE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |