C34H39ClN2O4 — CID 71090210
methyl 2-[4-chloro-3-[[2,3-dimethyl-5-[1-(3-propan-2-ylphenyl)ethylcarbamoyl]indol-1-yl]methyl]phenoxy]butanoate (PubChem CID 71090210) has the molecular formula C34H39ClN2O4 and a molecular weight of 575.15 g/mol. Its IUPAC name is methyl 2-[4-chloro-3-[[2,3-dimethyl-5-[1-(3-propan-2-ylphenyl)ethylcarbamoyl]indol-1-yl]methyl]phenoxy]butanoate.
| Compound Name | methyl 2-[4-chloro-3-[[2,3-dimethyl-5-[1-(3-propan-2-ylphenyl)ethylcarbamoyl]indol-1-yl]methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 71090210 |
| Molecular Formula | C34H39ClN2O4 |
| Molecular Weight | 575.15 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | methyl 2-[4-chloro-3-[[2,3-dimethyl-5-[1-(3-propan-2-ylphenyl)ethylcarbamoyl]indol-1-yl]methyl]phenoxy]butanoate |
| SMILES | CCC(Oc1ccc(Cl)c(Cn2c(C)c(C)c3cc(C(=O)NC(C)c4cccc(C(C)C)c4)ccc32)c1)C(=O)OC |
| InChI | InChI=1S/C34H39ClN2O4/c1-8-32(34(39)40-7)41-28-13-14-30(35)27(17-28)19-37-23(6)21(4)29-18-26(12-15-31(29)37)33(38)36-22(5)25-11-9-10-24(16-25)20(2)3/h9-18,20,22,32H,8,19H2,1-7H3,(H,36,38) |
| InChIKey | UAQUIQBWPKNBGV-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.15 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|