C14H22N4O — CID 71091055
5-(piperidin-1-ylmethyl)-3-pyridin-3-yl-1,2,4-oxadiazinane (PubChem CID 71091055) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 5-(piperidin-1-ylmethyl)-3-pyridin-3-yl-1,2,4-oxadiazinane.
| Compound Name | 5-(piperidin-1-ylmethyl)-3-pyridin-3-yl-1,2,4-oxadiazinane |
|---|---|
| PubChem CID | 71091055 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 5-(piperidin-1-ylmethyl)-3-pyridin-3-yl-1,2,4-oxadiazinane |
| SMILES | c1cncc(C2NOCC(CN3CCCCC3)N2)c1 |
| InChI | InChI=1S/C14H22N4O/c1-2-7-18(8-3-1)10-13-11-19-17-14(16-13)12-5-4-6-15-9-12/h4-6,9,13-14,16-17H,1-3,7-8,10-11H2 |
| InChIKey | ZYNIIVWNMIOILB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |