cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid

C9H15FN2O2 — CID 71093751

IUPACcyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid
SMILESO=C(O)N(C1CC1)[C@@H]1CCNC[C@@H]1F
InChIInChI=1S/C9H15FN2O2/c10-7-5-11-4-3-8(7)12(9(13)14)6-1-2-6/h6-8,11H,1-5H2,(H,13,14)/t7-,8+/m0/s1
InChIKeyTZLCVZVKTLFXLE-JGVFFNPUSA-N
MW202.23 g/mol
LogP0.83
Rot. Bonds2

About cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid

cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid (PubChem CID 71093751) has the molecular formula C9H15FN2O2 and a molecular weight of 202.23 g/mol. Its IUPAC name is cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid.

Molecular Properties

Compound Namecyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid
PubChem CID71093751
Molecular FormulaC9H15FN2O2
Molecular Weight202.23 g/mol
Exact Mass202.11
IUPAC Namecyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid
SMILESO=C(O)N(C1CC1)[C@@H]1CCNC[C@@H]1F
InChIInChI=1S/C9H15FN2O2/c10-7-5-11-4-3-8(7)12(9(13)14)6-1-2-6/h6-8,11H,1-5H2,(H,13,14)/t7-,8+/m0/s1
InChIKeyTZLCVZVKTLFXLE-JGVFFNPUSA-N
XLogP0.83
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.23
LogP ≤ 50.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid?
The IUPAC name of cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid (CID 71093751) is cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid.
What is the SMILES notation for cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid?
The canonical SMILES for cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid is O=C(O)N(C1CC1)[C@@H]1CCNC[C@@H]1F.
What is the InChIKey of cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid?
The InChIKey is TZLCVZVKTLFXLE-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H15FN2O2/c10-7-5-11-4-3-8(7)12(9(13)14)6-1-2-6/h6-8,11H,1-5H2,(H,13,14)/t7-,8+/m0/s1.
What are the key properties of cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid?
cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid has a molecular weight of 202.23 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[(3S,4R)-3-fluoropiperidin-4-yl]carbamic acid is sourced from PubChem (CID 71093751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).