C8H15FN2O2 — CID 69415587
[(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid (PubChem CID 69415587) has the molecular formula C8H15FN2O2 and a molecular weight of 190.22 g/mol. Its IUPAC name is [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid.
| Compound Name | [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 69415587 |
| Molecular Formula | C8H15FN2O2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid |
| SMILES | CN(C[C@@H]1CCNC[C@@H]1F)C(=O)O |
| InChI | InChI=1S/C8H15FN2O2/c1-11(8(12)13)5-6-2-3-10-4-7(6)9/h6-7,10H,2-5H2,1H3,(H,12,13)/t6-,7-/m0/s1 |
| InChIKey | VWXYKJXHSSJSFC-BQBZGAKWSA-N |
| XLogP | 0.54 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |