[(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid

C8H15FN2O2 — CID 69415587

IUPAC[(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid
SMILESCN(C[C@@H]1CCNC[C@@H]1F)C(=O)O
InChIInChI=1S/C8H15FN2O2/c1-11(8(12)13)5-6-2-3-10-4-7(6)9/h6-7,10H,2-5H2,1H3,(H,12,13)/t6-,7-/m0/s1
InChIKeyVWXYKJXHSSJSFC-BQBZGAKWSA-N
MW190.22 g/mol
LogP0.54
Rot. Bonds2

About [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid

[(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid (PubChem CID 69415587) has the molecular formula C8H15FN2O2 and a molecular weight of 190.22 g/mol. Its IUPAC name is [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid.

Molecular Properties

Compound Name[(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid
PubChem CID69415587
Molecular FormulaC8H15FN2O2
Molecular Weight190.22 g/mol
Exact Mass190.11
IUPAC Name[(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid
SMILESCN(C[C@@H]1CCNC[C@@H]1F)C(=O)O
InChIInChI=1S/C8H15FN2O2/c1-11(8(12)13)5-6-2-3-10-4-7(6)9/h6-7,10H,2-5H2,1H3,(H,12,13)/t6-,7-/m0/s1
InChIKeyVWXYKJXHSSJSFC-BQBZGAKWSA-N
XLogP0.54
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.22
LogP ≤ 50.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid?
The IUPAC name of [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid (CID 69415587) is [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid.
What is the SMILES notation for [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid?
The canonical SMILES for [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid is CN(C[C@@H]1CCNC[C@@H]1F)C(=O)O.
What is the InChIKey of [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid?
The InChIKey is VWXYKJXHSSJSFC-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H15FN2O2/c1-11(8(12)13)5-6-2-3-10-4-7(6)9/h6-7,10H,2-5H2,1H3,(H,12,13)/t6-,7-/m0/s1.
What are the key properties of [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid?
[(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid has a molecular weight of 190.22 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3-fluoropiperidin-4-yl]methyl-methylcarbamic acid is sourced from PubChem (CID 69415587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).