C13H27NO2 — CID 71094295
[1-(2,2-dimethylpropyl)piperidin-3-yl]-ethoxymethanol (PubChem CID 71094295) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is [1-(2,2-dimethylpropyl)piperidin-3-yl]-ethoxymethanol.
| Compound Name | [1-(2,2-dimethylpropyl)piperidin-3-yl]-ethoxymethanol |
|---|---|
| PubChem CID | 71094295 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | [1-(2,2-dimethylpropyl)piperidin-3-yl]-ethoxymethanol |
| SMILES | CCOC(O)C1CCCN(CC(C)(C)C)C1 |
| InChI | InChI=1S/C13H27NO2/c1-5-16-12(15)11-7-6-8-14(9-11)10-13(2,3)4/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | MXMAQGWMUMTNMJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|