C32H38N6O4 — CID 71098522
N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methyl]-4-methoxyaniline (PubChem CID 71098522) has the molecular formula C32H38N6O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methyl]-4-methoxyaniline.
| Compound Name | N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 71098522 |
| Molecular Formula | C32H38N6O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCc2cc(-c3ccc4c(N5CCOC[C@@H]5C)nc(N5CCOC[C@@H]5C)nc4n3)ccc2OC)cc1 |
| InChI | InChI=1S/C32H38N6O4/c1-21-19-41-15-13-37(21)31-27-10-11-28(34-30(27)35-32(36-31)38-14-16-42-20-22(38)2)23-5-12-29(40-4)24(17-23)18-33-25-6-8-26(39-3)9-7-25/h5-12,17,21-22,33H,13-16,18-20H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | AJIQTCSWSFSPLH-VXKWHMMOSA-N |
| XLogP | 4.77 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|