C38H39N3O3 — CID 71099329
benzyl (2R)-2-[(1S)-1-[[2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carbonyl]amino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 71099329) has the molecular formula C38H39N3O3 and a molecular weight of 585.75 g/mol. Its IUPAC name is benzyl (2R)-2-[(1S)-1-[[2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carbonyl]amino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[(1S)-1-[[2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carbonyl]amino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71099329 |
| Molecular Formula | C38H39N3O3 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | benzyl (2R)-2-[(1S)-1-[[2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carbonyl]amino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3)cc2)c2ccc(C(=O)N[C@@H](C)[C@H]3CCCN3C(=O)OCc3ccccc3)cc12 |
| InChI | InChI=1S/C38H39N3O3/c1-26-28(3)41(24-29-16-18-32(19-17-29)31-13-8-5-9-14-31)36-21-20-33(23-34(26)36)37(42)39-27(2)35-15-10-22-40(35)38(43)44-25-30-11-6-4-7-12-30/h4-9,11-14,16-21,23,27,35H,10,15,22,24-25H2,1-3H3,(H,39,42)/t27-,35+/m0/s1 |
| InChIKey | ICEONNVZXSKSOT-JCVFDAPQSA-N |
| XLogP | 7.89 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|