C31H37FN8O5 — CID 71100183
N'-[9-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide (PubChem CID 71100183) has the molecular formula C31H37FN8O5 and a molecular weight of 620.69 g/mol. Its IUPAC name is N'-[9-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide.
| Compound Name | N'-[9-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide |
|---|---|
| PubChem CID | 71100183 |
| Molecular Formula | C31H37FN8O5 |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | N'-[9-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide |
| SMILES | Cc1cc(CNC(=O)c2nc3n(c(=O)c2O)CC2(N4CCn5ccnc5C4)CCC3(N(C)C(=O)C(=O)N(C)C)CC2)ccc1F |
| InChI | InChI=1S/C31H37FN8O5/c1-19-15-20(5-6-21(19)32)16-34-25(42)23-24(41)26(43)40-18-30(39-14-13-38-12-11-33-22(38)17-39)7-9-31(10-8-30,29(40)35-23)37(4)28(45)27(44)36(2)3/h5-6,11-12,15,41H,7-10,13-14,16-18H2,1-4H3,(H,34,42) |
| InChIKey | ARKKFGFYAQMZDR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|