C24H27F2N5O5 — CID 67959914
N'-[9-fluoro-4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide (PubChem CID 67959914) has the molecular formula C24H27F2N5O5 and a molecular weight of 503.51 g/mol. Its IUPAC name is N'-[9-fluoro-4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide.
| Compound Name | N'-[9-fluoro-4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide |
|---|---|
| PubChem CID | 67959914 |
| Molecular Formula | C24H27F2N5O5 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | N'-[9-fluoro-4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide |
| SMILES | CN(C)C(=O)C(=O)N(C)C12CCC(F)(CC1)Cn1c2nc(C(=O)NCc2ccc(F)cc2)c(O)c1=O |
| InChI | InChI=1S/C24H27F2N5O5/c1-29(2)20(35)21(36)30(3)24-10-8-23(26,9-11-24)13-31-19(34)17(32)16(28-22(24)31)18(33)27-12-14-4-6-15(25)7-5-14/h4-7,32H,8-13H2,1-3H3,(H,27,33) |
| InChIKey | BYTFXGNTUBHWQC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|