C38H41FN6O6 — CID 67977049
N'-[4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-9-[[methyl-(2-naphthalen-1-ylacetyl)amino]methyl]-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide (PubChem CID 67977049) has the molecular formula C38H41FN6O6 and a molecular weight of 696.78 g/mol. Its IUPAC name is N'-[4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-9-[[methyl-(2-naphthalen-1-ylacetyl)amino]methyl]-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide.
| Compound Name | N'-[4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-9-[[methyl-(2-naphthalen-1-ylacetyl)amino]methyl]-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide |
|---|---|
| PubChem CID | 67977049 |
| Molecular Formula | C38H41FN6O6 |
| Molecular Weight | 696.78 g/mol |
| Exact Mass | 696.31 |
| IUPAC Name | N'-[4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-9-[[methyl-(2-naphthalen-1-ylacetyl)amino]methyl]-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N,N,N'-trimethyloxamide |
| SMILES | CN(C)C(=O)C(=O)N(C)C12CCC(CN(C)C(=O)Cc3cccc4ccccc34)(CC1)Cn1c2nc(C(=O)NCc2ccc(F)cc2)c(O)c1=O |
| InChI | InChI=1S/C38H41FN6O6/c1-42(2)34(50)35(51)44(4)38-18-16-37(17-19-38,22-43(3)29(46)20-26-10-7-9-25-8-5-6-11-28(25)26)23-45-33(49)31(47)30(41-36(38)45)32(48)40-21-24-12-14-27(39)15-13-24/h5-15,47H,16-23H2,1-4H3,(H,40,48) |
| InChIKey | GYRBAFRYGAYSOB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|