C32H32O4S3 — CID 71105098
2,5-bis[5-(2-methoxy-6-propan-2-yloxyphenyl)thiophen-2-yl]thiophene (PubChem CID 71105098) has the molecular formula C32H32O4S3 and a molecular weight of 576.81 g/mol. Its IUPAC name is 2,5-bis[5-(2-methoxy-6-propan-2-yloxyphenyl)thiophen-2-yl]thiophene.
| Compound Name | 2,5-bis[5-(2-methoxy-6-propan-2-yloxyphenyl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 71105098 |
| Molecular Formula | C32H32O4S3 |
| Molecular Weight | 576.81 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 2,5-bis[5-(2-methoxy-6-propan-2-yloxyphenyl)thiophen-2-yl]thiophene |
| SMILES | COc1cccc(OC(C)C)c1-c1ccc(-c2ccc(-c3ccc(-c4c(OC)cccc4OC(C)C)s3)s2)s1 |
| InChI | InChI=1S/C32H32O4S3/c1-19(2)35-23-11-7-9-21(33-5)31(23)29-17-15-27(38-29)25-13-14-26(37-25)28-16-18-30(39-28)32-22(34-6)10-8-12-24(32)36-20(3)4/h7-20H,1-6H3 |
| InChIKey | SUFUHQPOWJZSPU-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.81 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |