About 2-bromo-1,3-di(propan-2-yloxy)benzene
2-bromo-1,3-di(propan-2-yloxy)benzene (PubChem CID 102493711) has the molecular formula C12H17BrO2
and a molecular weight of 273.17 g/mol. Its IUPAC name is 2-bromo-1,3-di(propan-2-yloxy)benzene.
Molecular Properties
| Compound Name | 2-bromo-1,3-di(propan-2-yloxy)benzene |
| PubChem CID | 102493711 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-bromo-1,3-di(propan-2-yloxy)benzene |
| SMILES | CC(C)Oc1cccc(OC(C)C)c1Br |
| InChI | InChI=1S/C12H17BrO2/c1-8(2)14-10-6-5-7-11(12(10)13)15-9(3)4/h5-9H,1-4H3 |
| InChIKey | PQEBBXTVRWXCPH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-1,3-di(propan-2-yloxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-di(propan-2-yloxy)benzene?
The IUPAC name of 2-bromo-1,3-di(propan-2-yloxy)benzene (CID 102493711) is 2-bromo-1,3-di(propan-2-yloxy)benzene.
What is the SMILES notation for 2-bromo-1,3-di(propan-2-yloxy)benzene?
The canonical SMILES for 2-bromo-1,3-di(propan-2-yloxy)benzene is CC(C)Oc1cccc(OC(C)C)c1Br.
What is the InChIKey of 2-bromo-1,3-di(propan-2-yloxy)benzene?
The InChIKey is PQEBBXTVRWXCPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrO2/c1-8(2)14-10-6-5-7-11(12(10)13)15-9(3)4/h5-9H,1-4H3.
What are the key properties of 2-bromo-1,3-di(propan-2-yloxy)benzene?
2-bromo-1,3-di(propan-2-yloxy)benzene has a molecular weight of 273.17 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-di(propan-2-yloxy)benzene is sourced from PubChem (CID 102493711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).