About 2-propan-2-yloxyaniline;hydrochloride
2-propan-2-yloxyaniline;hydrochloride (PubChem CID 24779669) has the molecular formula C9H14ClNO
and a molecular weight of 187.67 g/mol. Its IUPAC name is 2-propan-2-yloxyaniline;hydrochloride.
Molecular Properties
| Compound Name | 2-propan-2-yloxyaniline;hydrochloride |
| PubChem CID | 24779669 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-propan-2-yloxyaniline;hydrochloride |
| SMILES | CC(C)Oc1ccccc1N.Cl |
| InChI | InChI=1S/C9H13NO.ClH/c1-7(2)11-9-6-4-3-5-8(9)10;/h3-7H,10H2,1-2H3;1H |
| InChIKey | FNNHHPXYKGNPLB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxyaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyaniline;hydrochloride?
The IUPAC name of 2-propan-2-yloxyaniline;hydrochloride (CID 24779669) is 2-propan-2-yloxyaniline;hydrochloride.
What is the SMILES notation for 2-propan-2-yloxyaniline;hydrochloride?
The canonical SMILES for 2-propan-2-yloxyaniline;hydrochloride is CC(C)Oc1ccccc1N.Cl.
What is the InChIKey of 2-propan-2-yloxyaniline;hydrochloride?
The InChIKey is FNNHHPXYKGNPLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.ClH/c1-7(2)11-9-6-4-3-5-8(9)10;/h3-7H,10H2,1-2H3;1H.
What are the key properties of 2-propan-2-yloxyaniline;hydrochloride?
2-propan-2-yloxyaniline;hydrochloride has a molecular weight of 187.67 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyaniline;hydrochloride is sourced from PubChem (CID 24779669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).