C14H14N6O2+2 — CID 57145330
1,2-bis(2-aminophenoxy)ethane-1,2-didiazonium (PubChem CID 57145330) has the molecular formula C14H14N6O2+2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 1,2-bis(2-aminophenoxy)ethane-1,2-didiazonium.
| Compound Name | 1,2-bis(2-aminophenoxy)ethane-1,2-didiazonium |
|---|---|
| PubChem CID | 57145330 |
| Molecular Formula | C14H14N6O2+2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1,2-bis(2-aminophenoxy)ethane-1,2-didiazonium |
| SMILES | N#[N+]C(Oc1ccccc1N)C([N+]#N)Oc1ccccc1N |
| InChI | InChI=1S/C14H14N6O2/c15-9-5-1-3-7-11(9)21-13(19-17)14(20-18)22-12-8-4-2-6-10(12)16/h1-8,13-14H,15-16H2/q+2 |
| InChIKey | IJBWUCMLCGCALG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|