C13H14IN3O — CID 88997771
4-[(2-aminophenoxy)-iodomethyl]benzene-1,2-diamine (PubChem CID 88997771) has the molecular formula C13H14IN3O and a molecular weight of 355.18 g/mol. Its IUPAC name is 4-[(2-aminophenoxy)-iodomethyl]benzene-1,2-diamine.
| Compound Name | 4-[(2-aminophenoxy)-iodomethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 88997771 |
| Molecular Formula | C13H14IN3O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-[(2-aminophenoxy)-iodomethyl]benzene-1,2-diamine |
| SMILES | Nc1ccc(C(I)Oc2ccccc2N)cc1N |
| InChI | InChI=1S/C13H14IN3O/c14-13(8-5-6-9(15)11(17)7-8)18-12-4-2-1-3-10(12)16/h1-7,13H,15-17H2 |
| InChIKey | MUUMUXSOFCOQFO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|