C26H40N2O6SSi — CID 71107837
2-[3-[(2R)-2-[[(2R)-4-[hydroxy(dimethyl)silyl]-2-[4-hydroxy-3-(methanesulfonamido)phenyl]-4-methylpentyl]amino]propyl]phenyl]acetic acid (PubChem CID 71107837) has the molecular formula C26H40N2O6SSi and a molecular weight of 536.77 g/mol. Its IUPAC name is 2-[3-[(2R)-2-[[(2R)-4-[hydroxy(dimethyl)silyl]-2-[4-hydroxy-3-(methanesulfonamido)phenyl]-4-methylpentyl]amino]propyl]phenyl]acetic acid.
| Compound Name | 2-[3-[(2R)-2-[[(2R)-4-[hydroxy(dimethyl)silyl]-2-[4-hydroxy-3-(methanesulfonamido)phenyl]-4-methylpentyl]amino]propyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 71107837 |
| Molecular Formula | C26H40N2O6SSi |
| Molecular Weight | 536.77 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 2-[3-[(2R)-2-[[(2R)-4-[hydroxy(dimethyl)silyl]-2-[4-hydroxy-3-(methanesulfonamido)phenyl]-4-methylpentyl]amino]propyl]phenyl]acetic acid |
| SMILES | C[C@H](Cc1cccc(CC(=O)O)c1)NC[C@H](CC(C)(C)[Si](C)(C)O)c1ccc(O)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C26H40N2O6SSi/c1-18(12-19-8-7-9-20(13-19)14-25(30)31)27-17-22(16-26(2,3)36(5,6)34)21-10-11-24(29)23(15-21)28-35(4,32)33/h7-11,13,15,18,22,27-29,34H,12,14,16-17H2,1-6H3,(H,30,31)/t18-,22+/m1/s1 |
| InChIKey | LXPLVVWTDKZETF-GCJKJVERSA-N |
| XLogP | 4.06 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.77 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|