C36H59N3O3 — CID 71107937
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[2-(4,5-dihydro-1H-imidazol-5-yl)ethylamino]-4-oxobutanoate (PubChem CID 71107937) has the molecular formula C36H59N3O3 and a molecular weight of 581.89 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[2-(4,5-dihydro-1H-imidazol-5-yl)ethylamino]-4-oxobutanoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[2-(4,5-dihydro-1H-imidazol-5-yl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 71107937 |
| Molecular Formula | C36H59N3O3 |
| Molecular Weight | 581.89 g/mol |
| Exact Mass | 581.46 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[2-(4,5-dihydro-1H-imidazol-5-yl)ethylamino]-4-oxobutanoate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CCC(=O)NCCC5CN=CN5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C36H59N3O3/c1-24(2)7-6-8-25(3)30-11-12-31-29-10-9-26-21-28(15-18-35(26,4)32(29)16-19-36(30,31)5)42-34(41)14-13-33(40)38-20-17-27-22-37-23-39-27/h9,23-25,27-32H,6-8,10-22H2,1-5H3,(H,37,39)(H,38,40) |
| InChIKey | JHDRURAJINFCEI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.89 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|