C19H19N5O — CID 71112077
16-methyl-6-pyridin-2-yl-1,7,9,12-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-3(8),4,6,9-tetraen-2-one (PubChem CID 71112077) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 16-methyl-6-pyridin-2-yl-1,7,9,12-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-3(8),4,6,9-tetraen-2-one.
| Compound Name | 16-methyl-6-pyridin-2-yl-1,7,9,12-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-3(8),4,6,9-tetraen-2-one |
|---|---|
| PubChem CID | 71112077 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 16-methyl-6-pyridin-2-yl-1,7,9,12-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-3(8),4,6,9-tetraen-2-one |
| SMILES | CC12CCCN1Cc1nc3nc(-c4ccccn4)ccc3c(=O)n1C2 |
| InChI | InChI=1S/C19H19N5O/c1-19-8-4-10-23(19)11-16-22-17-13(18(25)24(16)12-19)6-7-15(21-17)14-5-2-3-9-20-14/h2-3,5-7,9H,4,8,10-12H2,1H3 |
| InChIKey | HBUYQLURZCLDFR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |