C23H26N6O — CID 71113776
4-[4-[5-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)pyrido[3,4-b]pyrazin-7-yl]phenyl]morpholine (PubChem CID 71113776) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-[4-[5-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)pyrido[3,4-b]pyrazin-7-yl]phenyl]morpholine.
| Compound Name | 4-[4-[5-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)pyrido[3,4-b]pyrazin-7-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 71113776 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 4-[4-[5-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)pyrido[3,4-b]pyrazin-7-yl]phenyl]morpholine |
| SMILES | c1cnc2c(N3CCC4CNCC43)nc(-c3ccc(N4CCOCC4)cc3)cc2n1 |
| InChI | InChI=1S/C23H26N6O/c1-3-18(28-9-11-30-12-10-28)4-2-16(1)19-13-20-22(26-7-6-25-20)23(27-19)29-8-5-17-14-24-15-21(17)29/h1-4,6-7,13,17,21,24H,5,8-12,14-15H2 |
| InChIKey | UTPRIIBVPOBHDK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |