C20H22ClN3O — CID 143936489
4-[4-(5-chloro-1,6-naphthyridin-7-yl)phenyl]morpholine;ethane (PubChem CID 143936489) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 4-[4-(5-chloro-1,6-naphthyridin-7-yl)phenyl]morpholine;ethane.
| Compound Name | 4-[4-(5-chloro-1,6-naphthyridin-7-yl)phenyl]morpholine;ethane |
|---|---|
| PubChem CID | 143936489 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-[4-(5-chloro-1,6-naphthyridin-7-yl)phenyl]morpholine;ethane |
| SMILES | CC.Clc1nc(-c2ccc(N3CCOCC3)cc2)cc2ncccc12 |
| InChI | InChI=1S/C18H16ClN3O.C2H6/c19-18-15-2-1-7-20-17(15)12-16(21-18)13-3-5-14(6-4-13)22-8-10-23-11-9-22;1-2/h1-7,12H,8-11H2;1-2H3 |
| InChIKey | CCFAMUICBDQDFG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|