C26H31N5O2 — CID 91234911
2-[4-[[7-(4-morpholin-4-ylphenyl)-1,6-naphthyridin-5-yl]amino]cyclohexyl]acetamide (PubChem CID 91234911) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 2-[4-[[7-(4-morpholin-4-ylphenyl)-1,6-naphthyridin-5-yl]amino]cyclohexyl]acetamide.
| Compound Name | 2-[4-[[7-(4-morpholin-4-ylphenyl)-1,6-naphthyridin-5-yl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 91234911 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 2-[4-[[7-(4-morpholin-4-ylphenyl)-1,6-naphthyridin-5-yl]amino]cyclohexyl]acetamide |
| SMILES | NC(=O)CC1CCC(Nc2nc(-c3ccc(N4CCOCC4)cc3)cc3ncccc23)CC1 |
| InChI | InChI=1S/C26H31N5O2/c27-25(32)16-18-3-7-20(8-4-18)29-26-22-2-1-11-28-24(22)17-23(30-26)19-5-9-21(10-6-19)31-12-14-33-15-13-31/h1-2,5-6,9-11,17-18,20H,3-4,7-8,12-16H2,(H2,27,32)(H,29,30) |
| InChIKey | FXKDQCINEBOSQB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |