C26H31N5O2 — CID 67353594
N-[4-[[7-(4-morpholin-4-ylphenyl)-1,6-naphthyridin-5-yl]amino]cyclohexyl]acetamide (PubChem CID 67353594) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[4-[[7-(4-morpholin-4-ylphenyl)-1,6-naphthyridin-5-yl]amino]cyclohexyl]acetamide.
| Compound Name | N-[4-[[7-(4-morpholin-4-ylphenyl)-1,6-naphthyridin-5-yl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 67353594 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-[4-[[7-(4-morpholin-4-ylphenyl)-1,6-naphthyridin-5-yl]amino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(Nc2nc(-c3ccc(N4CCOCC4)cc3)cc3ncccc23)CC1 |
| InChI | InChI=1S/C26H31N5O2/c1-18(32)28-20-6-8-21(9-7-20)29-26-23-3-2-12-27-25(23)17-24(30-26)19-4-10-22(11-5-19)31-13-15-33-16-14-31/h2-5,10-12,17,20-21H,6-9,13-16H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | HPQYOFLHLHFXPB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |