C32H27N3O3S — CID 71114097
6,7-dibutyl-17-thiophen-2-yl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 71114097) has the molecular formula C32H27N3O3S and a molecular weight of 533.65 g/mol. Its IUPAC name is 6,7-dibutyl-17-thiophen-2-yl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 6,7-dibutyl-17-thiophen-2-yl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 71114097 |
| Molecular Formula | C32H27N3O3S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 6,7-dibutyl-17-thiophen-2-yl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | CCCCc1cc2nc3c4ccc5c6c(ccc(c(=O)n3c2cc1CCCC)c64)C(=O)N(c1cccs1)C5=O |
| InChI | InChI=1S/C32H27N3O3S/c1-3-5-8-18-16-24-25(17-19(18)9-6-4-2)34-29(33-24)20-11-12-22-28-23(14-13-21(27(20)28)30(34)36)32(38)35(31(22)37)26-10-7-15-39-26/h7,10-17H,3-6,8-9H2,1-2H3 |
| InChIKey | NYVLMJSFENWZIU-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|