C31H35N3O7 — CID 71114430
[(2R,3R,3aR,6R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-6-butoxy-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl] acetate (PubChem CID 71114430) has the molecular formula C31H35N3O7 and a molecular weight of 561.64 g/mol. Its IUPAC name is [(2R,3R,3aR,6R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-6-butoxy-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl] acetate.
| Compound Name | [(2R,3R,3aR,6R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-6-butoxy-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 71114430 |
| Molecular Formula | C31H35N3O7 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | [(2R,3R,3aR,6R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-6-butoxy-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl] acetate |
| SMILES | CCCCO[C@@H]1CC[C@@]2(OCc3ccccc3)C1O[C@@H](n1ccc(NC(=O)c3ccccc3)nc1=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C31H35N3O7/c1-3-4-19-38-24-15-17-31(39-20-22-11-7-5-8-12-22)26(24)41-29(27(31)40-21(2)35)34-18-16-25(33-30(34)37)32-28(36)23-13-9-6-10-14-23/h5-14,16,18,24,26-27,29H,3-4,15,17,19-20H2,1-2H3,(H,32,33,36,37)/t24-,26?,27+,29-,31-/m1/s1 |
| InChIKey | KZRKVINOCYCCPV-BDKVGOTRSA-N |
| XLogP | 4.26 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|