C24H35N3O — CID 7111600
1-[1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-yl]-4-(2-methoxyphenyl)piperazine (PubChem CID 7111600) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is 1-[1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-yl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-yl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 7111600 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | 1-[1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-yl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(C2CCN(C[C@@H]3C[C@@H]4C=C[C@@H]3C4)CC2)CC1 |
| InChI | InChI=1S/C24H35N3O/c1-28-24-5-3-2-4-23(24)27-14-12-26(13-15-27)22-8-10-25(11-9-22)18-21-17-19-6-7-20(21)16-19/h2-7,19-22H,8-18H2,1H3/t19-,20-,21+/m1/s1 |
| InChIKey | YDPTYMYWKPPRFW-NJYVYQBISA-N |
| XLogP | 3.49 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|