C17H20FN5S — CID 71117672
4-[[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]methyl]-3-(4-fluorophenyl)-1H-imidazole-2-thione (PubChem CID 71117672) has the molecular formula C17H20FN5S and a molecular weight of 345.45 g/mol. Its IUPAC name is 4-[[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]methyl]-3-(4-fluorophenyl)-1H-imidazole-2-thione.
| Compound Name | 4-[[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]methyl]-3-(4-fluorophenyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 71117672 |
| Molecular Formula | C17H20FN5S |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-[[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]methyl]-3-(4-fluorophenyl)-1H-imidazole-2-thione |
| SMILES | Cc1nn(C)cc1CN(C)Cc1c[nH]c(=S)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN5S/c1-12-13(10-22(3)20-12)9-21(2)11-16-8-19-17(24)23(16)15-6-4-14(18)5-7-15/h4-8,10H,9,11H2,1-3H3,(H,19,24) |
| InChIKey | GCGGKLCCCFUUHG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|