C11H14O4S — CID 71120238
4,4-dihydroxy-1-thiophen-3-ylcyclohexane-1-carboxylic acid (PubChem CID 71120238) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4,4-dihydroxy-1-thiophen-3-ylcyclohexane-1-carboxylic acid.
| Compound Name | 4,4-dihydroxy-1-thiophen-3-ylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 71120238 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4,4-dihydroxy-1-thiophen-3-ylcyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccsc2)CCC(O)(O)CC1 |
| InChI | InChI=1S/C11H14O4S/c12-9(13)10(8-1-6-16-7-8)2-4-11(14,15)5-3-10/h1,6-7,14-15H,2-5H2,(H,12,13) |
| InChIKey | PMXCQKGNRIHJRD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|