C15H22O5 — CID 71122612
2-hydroxy-2-[4-[(1-hydroxy-2,2-dimethylbutoxy)methyl]phenyl]acetic acid (PubChem CID 71122612) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-hydroxy-2-[4-[(1-hydroxy-2,2-dimethylbutoxy)methyl]phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[4-[(1-hydroxy-2,2-dimethylbutoxy)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 71122612 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-hydroxy-2-[4-[(1-hydroxy-2,2-dimethylbutoxy)methyl]phenyl]acetic acid |
| SMILES | CCC(C)(C)C(O)OCc1ccc(C(O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H22O5/c1-4-15(2,3)14(19)20-9-10-5-7-11(8-6-10)12(16)13(17)18/h5-8,12,14,16,19H,4,9H2,1-3H3,(H,17,18) |
| InChIKey | JQIZLPBHYIEJGF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|