C31H45N3O5 — CID 71124727
3-methoxy-N-[(3R)-1-[1-(4-methoxy-2,3-dimethylphenyl)ethyl]pyrrolidin-3-yl]-5-(4-morpholin-4-ylbutoxy)benzamide (PubChem CID 71124727) has the molecular formula C31H45N3O5 and a molecular weight of 539.72 g/mol. Its IUPAC name is 3-methoxy-N-[(3R)-1-[1-(4-methoxy-2,3-dimethylphenyl)ethyl]pyrrolidin-3-yl]-5-(4-morpholin-4-ylbutoxy)benzamide.
| Compound Name | 3-methoxy-N-[(3R)-1-[1-(4-methoxy-2,3-dimethylphenyl)ethyl]pyrrolidin-3-yl]-5-(4-morpholin-4-ylbutoxy)benzamide |
|---|---|
| PubChem CID | 71124727 |
| Molecular Formula | C31H45N3O5 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | 3-methoxy-N-[(3R)-1-[1-(4-methoxy-2,3-dimethylphenyl)ethyl]pyrrolidin-3-yl]-5-(4-morpholin-4-ylbutoxy)benzamide |
| SMILES | COc1cc(OCCCCN2CCOCC2)cc(C(=O)N[C@@H]2CCN(C(C)c3ccc(OC)c(C)c3C)C2)c1 |
| InChI | InChI=1S/C31H45N3O5/c1-22-23(2)30(37-5)9-8-29(22)24(3)34-12-10-26(21-34)32-31(35)25-18-27(36-4)20-28(19-25)39-15-7-6-11-33-13-16-38-17-14-33/h8-9,18-20,24,26H,6-7,10-17,21H2,1-5H3,(H,32,35)/t24?,26-/m1/s1 |
| InChIKey | ANRUQWTUPMWNIO-JUERFOTFSA-N |
| XLogP | 4.38 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|