C45H46N2 — CID 71125003
4-[4-(N-(4-hexan-3-ylphenyl)anilino)phenyl]-N-phenyl-N-(4-propan-2-ylphenyl)aniline (PubChem CID 71125003) has the molecular formula C45H46N2 and a molecular weight of 614.88 g/mol. Its IUPAC name is 4-[4-(N-(4-hexan-3-ylphenyl)anilino)phenyl]-N-phenyl-N-(4-propan-2-ylphenyl)aniline.
| Compound Name | 4-[4-(N-(4-hexan-3-ylphenyl)anilino)phenyl]-N-phenyl-N-(4-propan-2-ylphenyl)aniline |
|---|---|
| PubChem CID | 71125003 |
| Molecular Formula | C45H46N2 |
| Molecular Weight | 614.88 g/mol |
| Exact Mass | 614.37 |
| IUPAC Name | 4-[4-(N-(4-hexan-3-ylphenyl)anilino)phenyl]-N-phenyl-N-(4-propan-2-ylphenyl)aniline |
| SMILES | CCCC(CC)c1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4ccc(C(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H46N2/c1-5-13-35(6-2)37-20-28-43(29-21-37)47(41-16-11-8-12-17-41)45-32-24-39(25-33-45)38-22-30-44(31-23-38)46(40-14-9-7-10-15-40)42-26-18-36(19-27-42)34(3)4/h7-12,14-35H,5-6,13H2,1-4H3 |
| InChIKey | AWMXOTVPDVDWFJ-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.88 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |