C47H42O18 — CID 71126134
2-(3,4-dihydroxyphenyl)-6,8-bis[[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]methyl]-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 71126134) has the molecular formula C47H42O18 and a molecular weight of 894.83 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-6,8-bis[[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]methyl]-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | 2-(3,4-dihydroxyphenyl)-6,8-bis[[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]methyl]-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 71126134 |
| Molecular Formula | C47H42O18 |
| Molecular Weight | 894.83 g/mol |
| Exact Mass | 894.24 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-6,8-bis[[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]methyl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2Cc1c(O)c2c(c(CC3c4c(O)cc(O)cc4OC(c4ccc(O)c(O)c4)C3O)c1O)OC(c1ccc(O)c(O)c1)C(O)C2 |
| InChI | InChI=1S/C47H42O18/c48-20-10-33(56)38-22(42(61)45(63-36(38)12-20)18-2-5-28(51)31(54)8-18)14-24-40(59)25(47-26(41(24)60)16-35(58)44(65-47)17-1-4-27(50)30(53)7-17)15-23-39-34(57)11-21(49)13-37(39)64-46(43(23)62)19-3-6-29(52)32(55)9-19/h1-13,22-23,35,42-46,48-62H,14-16H2 |
| InChIKey | JUBNURIFWQQLTK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 331.14 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|