C15H21ClN2O2 — CID 71126533
2-[[(3R)-3-(4-chlorophenyl)-4-oxopentyl]amino]-N,N-dimethylacetamide (PubChem CID 71126533) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-[[(3R)-3-(4-chlorophenyl)-4-oxopentyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3R)-3-(4-chlorophenyl)-4-oxopentyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 71126533 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[[(3R)-3-(4-chlorophenyl)-4-oxopentyl]amino]-N,N-dimethylacetamide |
| SMILES | CC(=O)[C@H](CCNCC(=O)N(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-11(19)14(12-4-6-13(16)7-5-12)8-9-17-10-15(20)18(2)3/h4-7,14,17H,8-10H2,1-3H3/t14-/m0/s1 |
| InChIKey | HTTWVARFOKRRGK-AWEZNQCLSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|