C13H18BClNO — CID 71129145
CID 71129145 (PubChem CID 71129145) has the molecular formula C13H18BClNO and a molecular weight of 250.56 g/mol.
| Compound Name | CID 71129145 |
|---|---|
| PubChem CID | 71129145 |
| Molecular Formula | C13H18BClNO |
| Molecular Weight | 250.56 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc(NC(=O)CC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C13H18BClNO/c1-13(2,3)8-12(17)16-11-6-5-9(14-4)7-10(11)15/h5-7H,8H2,1-4H3,(H,16,17) |
| InChIKey | DGUUJUIDWJNECK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|