C22H30N2O3S — CID 71131676
2,6-ditert-butyl-4-methyl-4-[(4-methylsulfonylphenyl)diazenyl]cyclohexa-2,5-dien-1-one (PubChem CID 71131676) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methyl-4-[(4-methylsulfonylphenyl)diazenyl]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-methyl-4-[(4-methylsulfonylphenyl)diazenyl]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 71131676 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2,6-ditert-butyl-4-methyl-4-[(4-methylsulfonylphenyl)diazenyl]cyclohexa-2,5-dien-1-one |
| SMILES | CC1(/N=N/c2ccc(S(C)(=O)=O)cc2)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C22H30N2O3S/c1-20(2,3)17-13-22(7,14-18(19(17)25)21(4,5)6)24-23-15-9-11-16(12-10-15)28(8,26)27/h9-14H,1-8H3/b24-23+ |
| InChIKey | YXLFDVLPHZLLHN-WCWDXBQESA-N |
| XLogP | 5.46 |
| TPSA | 75.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|