C28H30N2O5 — CID 71133933
[1-(4-methoxybenzoyl)-4-phenylpiperidin-4-yl] N-[(4-methoxyphenyl)methyl]carbamate (PubChem CID 71133933) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is [1-(4-methoxybenzoyl)-4-phenylpiperidin-4-yl] N-[(4-methoxyphenyl)methyl]carbamate.
| Compound Name | [1-(4-methoxybenzoyl)-4-phenylpiperidin-4-yl] N-[(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 71133933 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [1-(4-methoxybenzoyl)-4-phenylpiperidin-4-yl] N-[(4-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CNC(=O)OC2(c3ccccc3)CCN(C(=O)c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H30N2O5/c1-33-24-12-8-21(9-13-24)20-29-27(32)35-28(23-6-4-3-5-7-23)16-18-30(19-17-28)26(31)22-10-14-25(34-2)15-11-22/h3-15H,16-20H2,1-2H3,(H,29,32) |
| InChIKey | SPARFYCJMZCRMO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |