C29H32N2O4 — CID 71134014
[1-(4-methoxybenzoyl)-4-phenylpiperidin-4-yl] N-(3-phenylpropyl)carbamate (PubChem CID 71134014) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is [1-(4-methoxybenzoyl)-4-phenylpiperidin-4-yl] N-(3-phenylpropyl)carbamate.
| Compound Name | [1-(4-methoxybenzoyl)-4-phenylpiperidin-4-yl] N-(3-phenylpropyl)carbamate |
|---|---|
| PubChem CID | 71134014 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | [1-(4-methoxybenzoyl)-4-phenylpiperidin-4-yl] N-(3-phenylpropyl)carbamate |
| SMILES | COc1ccc(C(=O)N2CCC(OC(=O)NCCCc3ccccc3)(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H32N2O4/c1-34-26-16-14-24(15-17-26)27(32)31-21-18-29(19-22-31,25-12-6-3-7-13-25)35-28(33)30-20-8-11-23-9-4-2-5-10-23/h2-7,9-10,12-17H,8,11,18-22H2,1H3,(H,30,33) |
| InChIKey | VIBCIBFSXXJBIE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|