C21H16F2N4O2 — CID 71134305
[2-(3-fluorophenyl)-4-methylpyrimidin-5-yl] N-(7-fluoro-3-methylindol-1-yl)carbamate (PubChem CID 71134305) has the molecular formula C21H16F2N4O2 and a molecular weight of 394.38 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-4-methylpyrimidin-5-yl] N-(7-fluoro-3-methylindol-1-yl)carbamate.
| Compound Name | [2-(3-fluorophenyl)-4-methylpyrimidin-5-yl] N-(7-fluoro-3-methylindol-1-yl)carbamate |
|---|---|
| PubChem CID | 71134305 |
| Molecular Formula | C21H16F2N4O2 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [2-(3-fluorophenyl)-4-methylpyrimidin-5-yl] N-(7-fluoro-3-methylindol-1-yl)carbamate |
| SMILES | Cc1nc(-c2cccc(F)c2)ncc1OC(=O)Nn1cc(C)c2cccc(F)c21 |
| InChI | InChI=1S/C21H16F2N4O2/c1-12-11-27(19-16(12)7-4-8-17(19)23)26-21(28)29-18-10-24-20(25-13(18)2)14-5-3-6-15(22)9-14/h3-11H,1-2H3,(H,26,28) |
| InChIKey | NGRGEVJVRGSBEN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |