C20H14F2N4O4S — CID 86639366
5-fluoro-1-[[2-(3-fluorophenyl)-4-methylpyrimidine-5-carbonyl]amino]indole-3-sulfonic acid (PubChem CID 86639366) has the molecular formula C20H14F2N4O4S and a molecular weight of 444.42 g/mol. Its IUPAC name is 5-fluoro-1-[[2-(3-fluorophenyl)-4-methylpyrimidine-5-carbonyl]amino]indole-3-sulfonic acid.
| Compound Name | 5-fluoro-1-[[2-(3-fluorophenyl)-4-methylpyrimidine-5-carbonyl]amino]indole-3-sulfonic acid |
|---|---|
| PubChem CID | 86639366 |
| Molecular Formula | C20H14F2N4O4S |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 5-fluoro-1-[[2-(3-fluorophenyl)-4-methylpyrimidine-5-carbonyl]amino]indole-3-sulfonic acid |
| SMILES | Cc1nc(-c2cccc(F)c2)ncc1C(=O)Nn1cc(S(=O)(=O)O)c2cc(F)ccc21 |
| InChI | InChI=1S/C20H14F2N4O4S/c1-11-16(9-23-19(24-11)12-3-2-4-13(21)7-12)20(27)25-26-10-18(31(28,29)30)15-8-14(22)5-6-17(15)26/h2-10H,1H3,(H,25,27)(H,28,29,30) |
| InChIKey | KBJSIPQKALNNAG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|