C21H15N3S — CID 7113675
(2R)-2-(1H-benzimidazol-2-yl)-3-phenyl-2H-1,4-benzothiazine (PubChem CID 7113675) has the molecular formula C21H15N3S and a molecular weight of 341.44 g/mol. Its IUPAC name is (2R)-2-(1H-benzimidazol-2-yl)-3-phenyl-2H-1,4-benzothiazine.
| Compound Name | (2R)-2-(1H-benzimidazol-2-yl)-3-phenyl-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 7113675 |
| Molecular Formula | C21H15N3S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (2R)-2-(1H-benzimidazol-2-yl)-3-phenyl-2H-1,4-benzothiazine |
| SMILES | c1ccc(C2=Nc3ccccc3S[C@H]2c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C21H15N3S/c1-2-8-14(9-3-1)19-20(25-18-13-7-6-12-17(18)22-19)21-23-15-10-4-5-11-16(15)24-21/h1-13,20H,(H,23,24)/t20-/m1/s1 |
| InChIKey | JIHQIRFYNAQVNT-HXUWFJFHSA-N |
| XLogP | 5.53 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |