C36H41N3O8 — CID 71141150
tert-butyl 4-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]propanoylamino]-3-methoxy-3-oxopropyl]benzoate (PubChem CID 71141150) has the molecular formula C36H41N3O8 and a molecular weight of 643.74 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]propanoylamino]-3-methoxy-3-oxopropyl]benzoate.
| Compound Name | tert-butyl 4-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]propanoylamino]-3-methoxy-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 71141150 |
| Molecular Formula | C36H41N3O8 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]propanoylamino]-3-methoxy-3-oxopropyl]benzoate |
| SMILES | COC(=O)C(Cc1ccc(C(=O)OC(C)(C)C)cc1)NC(=O)C(C)NC(=O)C(C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H41N3O8/c1-21(32(41)39-30(34(43)45-6)19-23-15-17-24(18-16-23)33(42)47-36(3,4)5)37-31(40)22(2)38-35(44)46-20-29-27-13-9-7-11-25(27)26-12-8-10-14-28(26)29/h7-18,21-22,29-30H,19-20H2,1-6H3,(H,37,40)(H,38,44)(H,39,41) |
| InChIKey | RZBBDEPKESQAKX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|