C22H21F3N4O — CID 71144426
1-[(S)-(3-propyl-2-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]-3-pyridin-3-ylurea (PubChem CID 71144426) has the molecular formula C22H21F3N4O and a molecular weight of 414.43 g/mol. Its IUPAC name is 1-[(S)-(3-propyl-2-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[(S)-(3-propyl-2-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 71144426 |
| Molecular Formula | C22H21F3N4O |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-[(S)-(3-propyl-2-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]-3-pyridin-3-ylurea |
| SMILES | CCCc1cccnc1[C@@H](NC(=O)Nc1cccnc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H21F3N4O/c1-2-5-15-6-3-13-27-19(15)20(16-8-10-17(11-9-16)22(23,24)25)29-21(30)28-18-7-4-12-26-14-18/h3-4,6-14,20H,2,5H2,1H3,(H2,28,29,30)/t20-/m0/s1 |
| InChIKey | ZFOQAHHEHRPFFA-FQEVSTJZSA-N |
| XLogP | 5.36 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |