C19H14BrF3N4O — CID 89311069
1-[(2-bromo-3-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]-3-pyridin-3-ylurea (PubChem CID 89311069) has the molecular formula C19H14BrF3N4O and a molecular weight of 451.25 g/mol. Its IUPAC name is 1-[(2-bromo-3-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[(2-bromo-3-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 89311069 |
| Molecular Formula | C19H14BrF3N4O |
| Molecular Weight | 451.25 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 1-[(2-bromo-3-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1cccnc1)NC(c1ccc(C(F)(F)F)cc1)c1cccnc1Br |
| InChI | InChI=1S/C19H14BrF3N4O/c20-17-15(4-2-10-25-17)16(12-5-7-13(8-6-12)19(21,22)23)27-18(28)26-14-3-1-9-24-11-14/h1-11,16H,(H2,26,27,28) |
| InChIKey | DKSYUYOIMDZKET-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.25 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|