C23H15F4N3O — CID 71144663
N-[(S)-(4-fluorophenyl)-[3-(trifluoromethyl)-2-pyridinyl]methyl]quinoline-7-carboxamide (PubChem CID 71144663) has the molecular formula C23H15F4N3O and a molecular weight of 425.39 g/mol. Its IUPAC name is N-[(S)-(4-fluorophenyl)-[3-(trifluoromethyl)-2-pyridinyl]methyl]quinoline-7-carboxamide.
| Compound Name | N-[(S)-(4-fluorophenyl)-[3-(trifluoromethyl)-2-pyridinyl]methyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 71144663 |
| Molecular Formula | C23H15F4N3O |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[(S)-(4-fluorophenyl)-[3-(trifluoromethyl)-2-pyridinyl]methyl]quinoline-7-carboxamide |
| SMILES | O=C(N[C@@H](c1ccc(F)cc1)c1ncccc1C(F)(F)F)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C23H15F4N3O/c24-17-9-7-15(8-10-17)20(21-18(23(25,26)27)4-2-12-29-21)30-22(31)16-6-5-14-3-1-11-28-19(14)13-16/h1-13,20H,(H,30,31)/t20-/m0/s1 |
| InChIKey | KHLQJMXGNUKLQZ-FQEVSTJZSA-N |
| XLogP | 5.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |